C9H18Cl3N2O2P — CID 135157302
N,N-bis(1-chloroethyl)-3-(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 135157302) has the molecular formula C9H18Cl3N2O2P and a molecular weight of 323.59 g/mol. Its IUPAC name is N,N-bis(1-chloroethyl)-3-(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | N,N-bis(1-chloroethyl)-3-(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 135157302 |
| Molecular Formula | C9H18Cl3N2O2P |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | N,N-bis(1-chloroethyl)-3-(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | CC(Cl)N(C(C)Cl)P1(=O)OCCCN1CCCl |
| InChI | InChI=1S/C9H18Cl3N2O2P/c1-8(11)14(9(2)12)17(15)13(6-4-10)5-3-7-16-17/h8-9H,3-7H2,1-2H3 |
| InChIKey | KLPXTQCUMXPVOW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|