C25H31ClN4O4 — CID 135157732
(4R)-4-[(1R)-1-[6-chloro-3-(propoxymethyl)imidazo[4,5-c]pyridin-4-yl]oxyethyl]-1-[(1R)-1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one (PubChem CID 135157732) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-[6-chloro-3-(propoxymethyl)imidazo[4,5-c]pyridin-4-yl]oxyethyl]-1-[(1R)-1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[(1R)-1-[6-chloro-3-(propoxymethyl)imidazo[4,5-c]pyridin-4-yl]oxyethyl]-1-[(1R)-1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135157732 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (4R)-4-[(1R)-1-[6-chloro-3-(propoxymethyl)imidazo[4,5-c]pyridin-4-yl]oxyethyl]-1-[(1R)-1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
| SMILES | CCCOCn1cnc2cc(Cl)nc(O[C@H](C)[C@@H]3CC(=O)N([C@H](C)c4ccc(OC)cc4)C3)c21 |
| InChI | InChI=1S/C25H31ClN4O4/c1-5-10-33-15-29-14-27-21-12-22(26)28-25(24(21)29)34-17(3)19-11-23(31)30(13-19)16(2)18-6-8-20(32-4)9-7-18/h6-9,12,14,16-17,19H,5,10-11,13,15H2,1-4H3/t16-,17-,19-/m1/s1 |
| InChIKey | CLFUIQPSMTXUFW-ZHALLVOQSA-N |
| XLogP | 4.85 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|