C22H31N3O2 — CID 135158014
(E)-3-[[[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-(methylideneamino)methylidene]amino]-2-methylprop-2-enoic acid (PubChem CID 135158014) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (E)-3-[[[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-(methylideneamino)methylidene]amino]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[[[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-(methylideneamino)methylidene]amino]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 135158014 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (E)-3-[[[ethyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)amino]-(methylideneamino)methylidene]amino]-2-methylprop-2-enoic acid |
| SMILES | C=N/C(=N\C=C(/C)C(=O)O)N(CC)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H31N3O2/c1-8-25(20(23-7)24-14-15(2)19(26)27)16-9-10-17-18(13-16)22(5,6)12-11-21(17,3)4/h9-10,13-14H,7-8,11-12H2,1-6H3,(H,26,27)/b15-14+,24-20+ |
| InChIKey | HTSVAYUZPQSUFK-HPSOTFSKSA-N |
| XLogP | 4.91 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|