C30H33F — CID 135158188
4-fluoro-10,10-dimethyl-1-pent-2-enyl-8-[(Z)-1-phenylprop-1-enyl]-2,9-dihydro-1H-anthracene (PubChem CID 135158188) has the molecular formula C30H33F and a molecular weight of 412.59 g/mol. Its IUPAC name is 4-fluoro-10,10-dimethyl-1-pent-2-enyl-8-[(Z)-1-phenylprop-1-enyl]-2,9-dihydro-1H-anthracene.
| Compound Name | 4-fluoro-10,10-dimethyl-1-pent-2-enyl-8-[(Z)-1-phenylprop-1-enyl]-2,9-dihydro-1H-anthracene |
|---|---|
| PubChem CID | 135158188 |
| Molecular Formula | C30H33F |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-fluoro-10,10-dimethyl-1-pent-2-enyl-8-[(Z)-1-phenylprop-1-enyl]-2,9-dihydro-1H-anthracene |
| SMILES | C/C=C(/c1ccccc1)c1cccc2c1CC1=C(C(F)=CCC1CC=CCC)C2(C)C |
| InChI | InChI=1S/C30H33F/c1-5-7-9-13-22-18-19-28(31)29-25(22)20-26-24(16-12-17-27(26)30(29,3)4)23(6-2)21-14-10-8-11-15-21/h6-12,14-17,19,22H,5,13,18,20H2,1-4H3/b9-7?,23-6- |
| InChIKey | WVJOKNAWGPYROV-RJMZLKCZSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|