About 2,3-dimethyl-1,4-diazonane
2,3-dimethyl-1,4-diazonane (PubChem CID 135158483) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-diazonane.
Molecular Properties
| Compound Name | 2,3-dimethyl-1,4-diazonane |
| PubChem CID | 135158483 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2,3-dimethyl-1,4-diazonane |
| SMILES | CC1NCCCCCNC1C |
| InChI | InChI=1S/C9H20N2/c1-8-9(2)11-7-5-3-4-6-10-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | NKXPGXFVRVWMRG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-1,4-diazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,4-diazonane?
The IUPAC name of 2,3-dimethyl-1,4-diazonane (CID 135158483) is 2,3-dimethyl-1,4-diazonane.
What is the SMILES notation for 2,3-dimethyl-1,4-diazonane?
The canonical SMILES for 2,3-dimethyl-1,4-diazonane is CC1NCCCCCNC1C.
What is the InChIKey of 2,3-dimethyl-1,4-diazonane?
The InChIKey is NKXPGXFVRVWMRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-8-9(2)11-7-5-3-4-6-10-8/h8-11H,3-7H2,1-2H3.
What are the key properties of 2,3-dimethyl-1,4-diazonane?
2,3-dimethyl-1,4-diazonane has a molecular weight of 156.27 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,4-diazonane is sourced from PubChem (CID 135158483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).