About 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole
2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole (PubChem CID 135158915) has the molecular formula C8H11FN2
and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole.
Molecular Properties
| Compound Name | 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole |
| PubChem CID | 135158915 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole |
| SMILES | C/C=C(/F)c1nc(C)cn1C |
| InChI | InChI=1S/C8H11FN2/c1-4-7(9)8-10-6(2)5-11(8)3/h4-5H,1-3H3/b7-4+ |
| InChIKey | YALFDFVNBQGUMR-QPJJXVBHSA-N |
| XLogP | 2.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole?
The IUPAC name of 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole (CID 135158915) is 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole.
What is the SMILES notation for 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole?
The canonical SMILES for 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole is C/C=C(/F)c1nc(C)cn1C.
What is the InChIKey of 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole?
The InChIKey is YALFDFVNBQGUMR-QPJJXVBHSA-N. The full InChI is InChI=1S/C8H11FN2/c1-4-7(9)8-10-6(2)5-11(8)3/h4-5H,1-3H3/b7-4+.
What are the key properties of 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole?
2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole has a molecular weight of 154.19 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1-fluoroprop-1-enyl]-1,4-dimethylimidazole is sourced from PubChem (CID 135158915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).