C28H32N8O2 — CID 135159048
[2-methyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-3-(3,5,6,7-tetrahydropyrrolo[3,4-f]benzimidazol-2-yl)-3,4-dihydropyrazol-4-yl] N,N-diethylcarbamate (PubChem CID 135159048) has the molecular formula C28H32N8O2 and a molecular weight of 512.62 g/mol. Its IUPAC name is [2-methyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-3-(3,5,6,7-tetrahydropyrrolo[3,4-f]benzimidazol-2-yl)-3,4-dihydropyrazol-4-yl] N,N-diethylcarbamate.
| Compound Name | [2-methyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-3-(3,5,6,7-tetrahydropyrrolo[3,4-f]benzimidazol-2-yl)-3,4-dihydropyrazol-4-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 135159048 |
| Molecular Formula | C28H32N8O2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [2-methyl-5-[4-(pyrazol-1-ylmethyl)phenyl]-3-(3,5,6,7-tetrahydropyrrolo[3,4-f]benzimidazol-2-yl)-3,4-dihydropyrazol-4-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1C(c2ccc(Cn3cccn3)cc2)=NN(C)C1c1nc2cc3c(cc2[nH]1)CNC3 |
| InChI | InChI=1S/C28H32N8O2/c1-4-35(5-2)28(37)38-26-24(19-9-7-18(8-10-19)17-36-12-6-11-30-36)33-34(3)25(26)27-31-22-13-20-15-29-16-21(20)14-23(22)32-27/h6-14,25-26,29H,4-5,15-17H2,1-3H3,(H,31,32) |
| InChIKey | ACWGKHRGJGMQHS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |