C11H18N4O — CID 135159616
(3R)-3-amino-N,1,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide (PubChem CID 135159616) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (3R)-3-amino-N,1,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide.
| Compound Name | (3R)-3-amino-N,1,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135159616 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3R)-3-amino-N,1,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1CCN2C(C)=N[C@@H](N)C(C)=C12 |
| InChI | InChI=1S/C11H18N4O/c1-6-9-8(11(16)13-3)4-5-15(9)7(2)14-10(6)12/h8,10H,4-5,12H2,1-3H3,(H,13,16)/t8?,10-/m1/s1 |
| InChIKey | ZCTNCVMDKIUSKQ-LHIURRSHSA-N |
| XLogP | 0.05 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |