C21H25ClFN4O5PS — CID 135159628
methyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159628) has the molecular formula C21H25ClFN4O5PS and a molecular weight of 530.95 g/mol. Its IUPAC name is methyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159628 |
| Molecular Formula | C21H25ClFN4O5PS |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | methyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | C=C(F)/C=C\C(=C(/C)Cl)[C@@H]1N=C(c2nccs2)N2C[C@@H](NP(=O)(OC)OC)CC2=C1C(=O)OC |
| InChI | InChI=1S/C21H25ClFN4O5PS/c1-12(23)6-7-15(13(2)22)18-17(21(28)30-3)16-10-14(26-33(29,31-4)32-5)11-27(16)19(25-18)20-24-8-9-34-20/h6-9,14,18H,1,10-11H2,2-5H3,(H,26,29)/b7-6-,15-13-/t14-,18-/m0/s1 |
| InChIKey | SJUQSNVLYLCBIW-HAVKGLDJSA-N |
| XLogP | 4.32 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|