C21H22ClFN4O2S2 — CID 135159638
ethyl 3-(2-chloro-5-fluorocyclohepta-1,4,6-trien-1-yl)-6-(methylsulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159638) has the molecular formula C21H22ClFN4O2S2 and a molecular weight of 481.02 g/mol. Its IUPAC name is ethyl 3-(2-chloro-5-fluorocyclohepta-1,4,6-trien-1-yl)-6-(methylsulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl 3-(2-chloro-5-fluorocyclohepta-1,4,6-trien-1-yl)-6-(methylsulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159638 |
| Molecular Formula | C21H22ClFN4O2S2 |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | ethyl 3-(2-chloro-5-fluorocyclohepta-1,4,6-trien-1-yl)-6-(methylsulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(NSC)CN2C(c2nccs2)=NC1C1=C(Cl)CC=C(F)C=C1 |
| InChI | InChI=1S/C21H22ClFN4O2S2/c1-3-29-21(28)17-16-10-13(26-30-2)11-27(16)19(20-24-8-9-31-20)25-18(17)14-6-4-12(23)5-7-15(14)22/h4-6,8-9,13,18,26H,3,7,10-11H2,1-2H3 |
| InChIKey | TXFCGJMKFGQGRO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|