C19H21ClFN5O4S2 — CID 135159664
methyl (3S,6S)-3-[(3Z,5E)-7-chloro-5-fluorohepta-1,3,5-trien-2-yl]-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159664) has the molecular formula C19H21ClFN5O4S2 and a molecular weight of 501.99 g/mol. Its IUPAC name is methyl (3S,6S)-3-[(3Z,5E)-7-chloro-5-fluorohepta-1,3,5-trien-2-yl]-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3S,6S)-3-[(3Z,5E)-7-chloro-5-fluorohepta-1,3,5-trien-2-yl]-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159664 |
| Molecular Formula | C19H21ClFN5O4S2 |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | methyl (3S,6S)-3-[(3Z,5E)-7-chloro-5-fluorohepta-1,3,5-trien-2-yl]-6-(sulfamoylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | C=C(/C=C\C(F)=C/CCl)[C@@H]1N=C(c2nccs2)N2C[C@@H](NS(N)(=O)=O)CC2=C1C(=O)OC |
| InChI | InChI=1S/C19H21ClFN5O4S2/c1-11(3-4-12(21)5-6-20)16-15(19(27)30-2)14-9-13(25-32(22,28)29)10-26(14)17(24-16)18-23-7-8-31-18/h3-5,7-8,13,16,25H,1,6,9-10H2,2H3,(H2,22,28,29)/b4-3-,12-5+/t13-,16-/m0/s1 |
| InChIKey | ONDCCKCSSFKEOF-XBUMMKJYSA-N |
| XLogP | 1.77 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|