C22H24BrFN4O4S — CID 135159686
ethyl (8R)-8-(2-bromo-4-fluorophenyl)-2-(2-hydroxy-2-methoxyethyl)-6-(1,3-thiazol-2-yl)-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-9-carboxylate (PubChem CID 135159686) has the molecular formula C22H24BrFN4O4S and a molecular weight of 539.43 g/mol. Its IUPAC name is ethyl (8R)-8-(2-bromo-4-fluorophenyl)-2-(2-hydroxy-2-methoxyethyl)-6-(1,3-thiazol-2-yl)-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-9-carboxylate.
| Compound Name | ethyl (8R)-8-(2-bromo-4-fluorophenyl)-2-(2-hydroxy-2-methoxyethyl)-6-(1,3-thiazol-2-yl)-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-9-carboxylate |
|---|---|
| PubChem CID | 135159686 |
| Molecular Formula | C22H24BrFN4O4S |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | ethyl (8R)-8-(2-bromo-4-fluorophenyl)-2-(2-hydroxy-2-methoxyethyl)-6-(1,3-thiazol-2-yl)-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-9-carboxylate |
| SMILES | CCOC(=O)C1=C2CN(CC(O)OC)CCN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Br |
| InChI | InChI=1S/C22H24BrFN4O4S/c1-3-32-22(30)18-16-11-27(12-17(29)31-2)7-8-28(16)20(21-25-6-9-33-21)26-19(18)14-5-4-13(24)10-15(14)23/h4-6,9-10,17,19,29H,3,7-8,11-12H2,1-2H3/t17?,19-/m0/s1 |
| InChIKey | ZEGBNHXYQGEISH-NNBQYGFHSA-N |
| XLogP | 2.95 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|