C20H21BrFN3OS — CID 135159705
(6R)-3-[(3Z,5E)-4-bromo-6-fluorohepta-1,3,5-trien-3-yl]-6-ethyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde (PubChem CID 135159705) has the molecular formula C20H21BrFN3OS and a molecular weight of 450.38 g/mol. Its IUPAC name is (6R)-3-[(3Z,5E)-4-bromo-6-fluorohepta-1,3,5-trien-3-yl]-6-ethyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde.
| Compound Name | (6R)-3-[(3Z,5E)-4-bromo-6-fluorohepta-1,3,5-trien-3-yl]-6-ethyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 135159705 |
| Molecular Formula | C20H21BrFN3OS |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (6R)-3-[(3Z,5E)-4-bromo-6-fluorohepta-1,3,5-trien-3-yl]-6-ethyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
| SMILES | C=C/C(=C(Br)\C=C(/C)F)C1N=C(c2nccs2)N2C[C@H](CC)CC2=C1C=O |
| InChI | InChI=1S/C20H21BrFN3OS/c1-4-13-9-17-15(11-26)18(14(5-2)16(21)8-12(3)22)24-19(25(17)10-13)20-23-6-7-27-20/h5-8,11,13,18H,2,4,9-10H2,1,3H3/b12-8+,16-14-/t13-,18?/m1/s1 |
| InChIKey | ZOYQCSUPRNWWHX-ZLGADOSGSA-N |
| XLogP | 5.17 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|