C20H21ClFN3O3S — CID 135159719
ethyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-hydroxy-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159719) has the molecular formula C20H21ClFN3O3S and a molecular weight of 437.92 g/mol. Its IUPAC name is ethyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-hydroxy-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-hydroxy-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159719 |
| Molecular Formula | C20H21ClFN3O3S |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl (3R,6S)-3-[(2Z,4Z)-2-chloro-6-fluorohepta-2,4,6-trien-3-yl]-6-hydroxy-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | C=C(F)/C=C\C(=C(/C)Cl)[C@@H]1N=C(c2nccs2)N2C[C@@H](O)CC2=C1C(=O)OCC |
| InChI | InChI=1S/C20H21ClFN3O3S/c1-4-28-20(27)16-15-9-13(26)10-25(15)18(19-23-7-8-29-19)24-17(16)14(12(3)21)6-5-11(2)22/h5-8,13,17,26H,2,4,9-10H2,1,3H3/b6-5-,14-12-/t13-,17-/m0/s1 |
| InChIKey | KHUOLWLFSWDSAH-STGUQGMQSA-N |
| XLogP | 3.71 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|