C20H23ClFN4O5PS — CID 135159836
methyl (3R,6S)-3-(2-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159836) has the molecular formula C20H23ClFN4O5PS and a molecular weight of 516.92 g/mol. Its IUPAC name is methyl (3R,6S)-3-(2-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6S)-3-(2-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159836 |
| Molecular Formula | C20H23ClFN4O5PS |
| Molecular Weight | 516.92 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | methyl (3R,6S)-3-(2-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-6-(dimethoxyphosphorylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COC(=O)C1=C2C[C@H](NP(=O)(OC)OC)CN2C(c2nccs2)=N[C@H]1C1=C(Cl)C=C(F)CC1 |
| InChI | InChI=1S/C20H23ClFN4O5PS/c1-29-20(27)16-15-9-12(25-32(28,30-2)31-3)10-26(15)18(19-23-6-7-33-19)24-17(16)13-5-4-11(22)8-14(13)21/h6-8,12,17H,4-5,9-10H2,1-3H3,(H,25,28)/t12-,17-/m0/s1 |
| InChIKey | LCYXTZKXBKFVCY-SJCJKPOMSA-N |
| XLogP | 3.90 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|