C8H10F3NS — CID 135159898
(3Z,5E)-1,1,1-trifluoro-N-methyl-6-methylsulfanylhexa-3,5-dien-2-imine (PubChem CID 135159898) has the molecular formula C8H10F3NS and a molecular weight of 209.24 g/mol. Its IUPAC name is (3Z,5E)-1,1,1-trifluoro-N-methyl-6-methylsulfanylhexa-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-1,1,1-trifluoro-N-methyl-6-methylsulfanylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 135159898 |
| Molecular Formula | C8H10F3NS |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (3Z,5E)-1,1,1-trifluoro-N-methyl-6-methylsulfanylhexa-3,5-dien-2-imine |
| SMILES | C/N=C(/C=C\C=C\SC)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NS/c1-12-7(8(9,10)11)5-3-4-6-13-2/h3-6H,1-2H3/b5-3-,6-4+,12-7- |
| InChIKey | BVTKVQHXDDLUSP-CASBSOMUSA-N |
| XLogP | 3.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|