About (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine
(2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine (PubChem CID 135160309) has the molecular formula C12H20F3N3
and a molecular weight of 263.31 g/mol. Its IUPAC name is (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine |
| PubChem CID | 135160309 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine |
| SMILES | C=C(/C=C\C(NC)N1CCNC(C)C1)C(F)(F)F |
| InChI | InChI=1S/C12H20F3N3/c1-9(12(13,14)15)4-5-11(16-3)18-7-6-17-10(2)8-18/h4-5,10-11,16-17H,1,6-8H2,2-3H3/b5-4- |
| InChIKey | NSUWQJGPGXIWTD-PLNGDYQASA-N |
| XLogP | 1.50 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine?
The IUPAC name of (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine (CID 135160309) is (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine.
What is the SMILES notation for (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine?
The canonical SMILES for (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine is C=C(/C=C\C(NC)N1CCNC(C)C1)C(F)(F)F.
What is the InChIKey of (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine?
The InChIKey is NSUWQJGPGXIWTD-PLNGDYQASA-N. The full InChI is InChI=1S/C12H20F3N3/c1-9(12(13,14)15)4-5-11(16-3)18-7-6-17-10(2)8-18/h4-5,10-11,16-17H,1,6-8H2,2-3H3/b5-4-.
What are the key properties of (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine?
(2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine has a molecular weight of 263.31 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-methyl-1-(3-methylpiperazin-1-yl)-4-(trifluoromethyl)penta-2,4-dien-1-amine is sourced from PubChem (CID 135160309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).