C22H38S — CID 135160437
1-[(2Z)-3-ethenyl-7,9-dimethylundeca-2,5-dien-2-yl]sulfanyl-4-methylcyclohexane (PubChem CID 135160437) has the molecular formula C22H38S and a molecular weight of 334.61 g/mol. Its IUPAC name is 1-[(2Z)-3-ethenyl-7,9-dimethylundeca-2,5-dien-2-yl]sulfanyl-4-methylcyclohexane.
| Compound Name | 1-[(2Z)-3-ethenyl-7,9-dimethylundeca-2,5-dien-2-yl]sulfanyl-4-methylcyclohexane |
|---|---|
| PubChem CID | 135160437 |
| Molecular Formula | C22H38S |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-[(2Z)-3-ethenyl-7,9-dimethylundeca-2,5-dien-2-yl]sulfanyl-4-methylcyclohexane |
| SMILES | C=C/C(CC=CC(C)CC(C)CC)=C(/C)SC1CCC(C)CC1 |
| InChI | InChI=1S/C22H38S/c1-7-17(3)16-19(5)10-9-11-21(8-2)20(6)23-22-14-12-18(4)13-15-22/h8-10,17-19,22H,2,7,11-16H2,1,3-6H3/b10-9?,21-20+ |
| InChIKey | OMVZAAYYZVMJEY-FDIKABFBSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|