C17H28N4 — CID 135160663
(5Z)-4-N-[(5E)-5-hydrazinylidenepentyl]-5-methyl-2-N-methylidene-3-propan-2-ylidenehepta-1,5-diene-2,4-diimine (PubChem CID 135160663) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is (5Z)-4-N-[(5E)-5-hydrazinylidenepentyl]-5-methyl-2-N-methylidene-3-propan-2-ylidenehepta-1,5-diene-2,4-diimine.
| Compound Name | (5Z)-4-N-[(5E)-5-hydrazinylidenepentyl]-5-methyl-2-N-methylidene-3-propan-2-ylidenehepta-1,5-diene-2,4-diimine |
|---|---|
| PubChem CID | 135160663 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (5Z)-4-N-[(5E)-5-hydrazinylidenepentyl]-5-methyl-2-N-methylidene-3-propan-2-ylidenehepta-1,5-diene-2,4-diimine |
| SMILES | C=NC(=C)C(=C(C)C)C(=N/CCCC/C=N/N)/C(C)=C\C |
| InChI | InChI=1S/C17H28N4/c1-7-14(4)17(16(13(2)3)15(5)19-6)20-11-9-8-10-12-21-18/h7,12H,5-6,8-11,18H2,1-4H3/b14-7-,20-17+,21-12+ |
| InChIKey | DVMBEZNDNNHPIJ-RQVIFLPPSA-N |
| XLogP | 4.06 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|