C27H36F2N6O2 — CID 135160959
N'-(2,6-difluoro-3,5-dimethoxyphenyl)-N-methyl-N'-[(2E,4E)-7-methyl-5-(methylideneamino)-6-[1-(1-methylpyrazol-4-yl)ethylideneamino]octa-2,4,6-trien-2-yl]ethane-1,2-diamine (PubChem CID 135160959) has the molecular formula C27H36F2N6O2 and a molecular weight of 514.62 g/mol. Its IUPAC name is N'-(2,6-difluoro-3,5-dimethoxyphenyl)-N-methyl-N'-[(2E,4E)-7-methyl-5-(methylideneamino)-6-[1-(1-methylpyrazol-4-yl)ethylideneamino]octa-2,4,6-trien-2-yl]ethane-1,2-diamine.
| Compound Name | N'-(2,6-difluoro-3,5-dimethoxyphenyl)-N-methyl-N'-[(2E,4E)-7-methyl-5-(methylideneamino)-6-[1-(1-methylpyrazol-4-yl)ethylideneamino]octa-2,4,6-trien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 135160959 |
| Molecular Formula | C27H36F2N6O2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | N'-(2,6-difluoro-3,5-dimethoxyphenyl)-N-methyl-N'-[(2E,4E)-7-methyl-5-(methylideneamino)-6-[1-(1-methylpyrazol-4-yl)ethylideneamino]octa-2,4,6-trien-2-yl]ethane-1,2-diamine |
| SMILES | C=N/C(=C/C=C(\C)N(CCNC)c1c(F)c(OC)cc(OC)c1F)C(/N=C(\C)c1cnn(C)c1)=C(C)C |
| InChI | InChI=1S/C27H36F2N6O2/c1-17(2)26(33-19(4)20-15-32-34(7)16-20)21(31-6)11-10-18(3)35(13-12-30-5)27-24(28)22(36-8)14-23(37-9)25(27)29/h10-11,14-16,30H,6,12-13H2,1-5,7-9H3/b18-10+,21-11+,33-19+ |
| InChIKey | WWDVCNKXRRHHBO-ZVPXWQKFSA-N |
| XLogP | 5.03 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|