C22H34F2O2 — CID 135161125
1-[[(1Z,3E,5E)-6-ethoxy-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethyl]-4-(4-methylcyclohexyl)cyclohexane (PubChem CID 135161125) has the molecular formula C22H34F2O2 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[[(1Z,3E,5E)-6-ethoxy-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethyl]-4-(4-methylcyclohexyl)cyclohexane.
| Compound Name | 1-[[(1Z,3E,5E)-6-ethoxy-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethyl]-4-(4-methylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 135161125 |
| Molecular Formula | C22H34F2O2 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[[(1Z,3E,5E)-6-ethoxy-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethyl]-4-(4-methylcyclohexyl)cyclohexane |
| SMILES | CCO/C=C/C=C(OCC1CCC(C2CCC(C)CC2)CC1)\C(F)=C\F |
| InChI | InChI=1S/C22H34F2O2/c1-3-25-14-4-5-22(21(24)15-23)26-16-18-8-12-20(13-9-18)19-10-6-17(2)7-11-19/h4-5,14-15,17-20H,3,6-13,16H2,1-2H3/b14-4+,21-15-,22-5+ |
| InChIKey | DMFZFFZUIGXQAA-MHBKOMRHSA-N |
| XLogP | 6.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|