C20H21FO4 — CID 135161134
[(3Z,6E,8Z)-8-fluoro-5-methylidene-9-(2-methylprop-2-enoyloxy)undeca-1,3,6,8,10-pentaen-2-yl] 2-methylprop-2-enoate (PubChem CID 135161134) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is [(3Z,6E,8Z)-8-fluoro-5-methylidene-9-(2-methylprop-2-enoyloxy)undeca-1,3,6,8,10-pentaen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [(3Z,6E,8Z)-8-fluoro-5-methylidene-9-(2-methylprop-2-enoyloxy)undeca-1,3,6,8,10-pentaen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135161134 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [(3Z,6E,8Z)-8-fluoro-5-methylidene-9-(2-methylprop-2-enoyloxy)undeca-1,3,6,8,10-pentaen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C/C(OC(=O)C(=C)C)=C(F)\C=C\C(=C)/C=C/C(=C)OC(=O)C(=C)C |
| InChI | InChI=1S/C20H21FO4/c1-8-18(25-20(23)14(4)5)17(21)12-10-15(6)9-11-16(7)24-19(22)13(2)3/h8-12H,1-2,4,6-7H2,3,5H3/b11-9-,12-10+,18-17- |
| InChIKey | MSVZMHXKAJOCMC-PVVPRHBSSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|