C15H20N2O — CID 135161153
(5Z)-6-methyl-4-prop-2-enyl-3,7,10,11-tetrahydro-1H-1,4-benzodiazonin-2-one (PubChem CID 135161153) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (5Z)-6-methyl-4-prop-2-enyl-3,7,10,11-tetrahydro-1H-1,4-benzodiazonin-2-one.
| Compound Name | (5Z)-6-methyl-4-prop-2-enyl-3,7,10,11-tetrahydro-1H-1,4-benzodiazonin-2-one |
|---|---|
| PubChem CID | 135161153 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (5Z)-6-methyl-4-prop-2-enyl-3,7,10,11-tetrahydro-1H-1,4-benzodiazonin-2-one |
| SMILES | C=CCN1/C=C(/C)CC2=C(CCC=C2)NC(=O)C1 |
| InChI | InChI=1S/C15H20N2O/c1-3-8-17-10-12(2)9-13-6-4-5-7-14(13)16-15(18)11-17/h3-4,6,10H,1,5,7-9,11H2,2H3,(H,16,18)/b12-10- |
| InChIKey | WXMKTFRRUALXBY-BENRWUELSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|