About N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine
N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine (PubChem CID 135161413) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine.
Molecular Properties
| Compound Name | N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine |
| PubChem CID | 135161413 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine |
| SMILES | C=CC/C=C\CC=C(N=C)C(C)C |
| InChI | InChI=1S/C12H19N/c1-5-6-7-8-9-10-12(13-4)11(2)3/h5,7-8,10-11H,1,4,6,9H2,2-3H3/b8-7-,12-10? |
| InChIKey | RANFERXVILEJSW-FIWSIPJWSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine?
The IUPAC name of N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine (CID 135161413) is N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine.
What is the SMILES notation for N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine?
The canonical SMILES for N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine is C=CC/C=C\CC=C(N=C)C(C)C.
What is the InChIKey of N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine?
The InChIKey is RANFERXVILEJSW-FIWSIPJWSA-N. The full InChI is InChI=1S/C12H19N/c1-5-6-7-8-9-10-12(13-4)11(2)3/h5,7-8,10-11H,1,4,6,9H2,2-3H3/b8-7-,12-10?.
What are the key properties of N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine?
N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine has a molecular weight of 177.29 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6Z)-2-methyldeca-3,6,9-trien-3-yl]methanimine is sourced from PubChem (CID 135161413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).