About 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine
4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine (PubChem CID 135161873) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine |
| PubChem CID | 135161873 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine |
| SMILES | CC1=CN(C)NC1C1CCN(C)CC1 |
| InChI | InChI=1S/C11H21N3/c1-9-8-14(3)12-11(9)10-4-6-13(2)7-5-10/h8,10-12H,4-7H2,1-3H3 |
| InChIKey | WXIYTISXMLCFOI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine?
The IUPAC name of 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine (CID 135161873) is 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine.
What is the SMILES notation for 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine?
The canonical SMILES for 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine is CC1=CN(C)NC1C1CCN(C)CC1.
What is the InChIKey of 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine?
The InChIKey is WXIYTISXMLCFOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-9-8-14(3)12-11(9)10-4-6-13(2)7-5-10/h8,10-12H,4-7H2,1-3H3.
What are the key properties of 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine?
4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine has a molecular weight of 195.31 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-1,5-dihydropyrazol-5-yl)-1-methylpiperidine is sourced from PubChem (CID 135161873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).