C6H12N2 — CID 135162433
4,5-dimethyl-1,2,3,4-tetrahydropyridazine (PubChem CID 135162433) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 4,5-dimethyl-1,2,3,4-tetrahydropyridazine.
| Compound Name | 4,5-dimethyl-1,2,3,4-tetrahydropyridazine |
|---|---|
| PubChem CID | 135162433 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 4,5-dimethyl-1,2,3,4-tetrahydropyridazine |
| SMILES | CC1=CNNCC1C |
| InChI | InChI=1S/C6H12N2/c1-5-3-7-8-4-6(5)2/h3,6-8H,4H2,1-2H3 |
| InChIKey | JNTYFGHPDQWSFM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |