About 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine
2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine (PubChem CID 135162473) has the molecular formula C30H35NS
and a molecular weight of 441.68 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine.
Molecular Properties
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine |
| PubChem CID | 135162473 |
| Molecular Formula | C30H35NS |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine |
| SMILES | C=C(C/N=C(\CCCCCC)C(=C)c1ccc(SC2=CCCC=C2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H35NS/c1-4-5-6-13-18-30(31-23-24(2)26-14-9-7-10-15-26)25(3)27-19-21-29(22-20-27)32-28-16-11-8-12-17-28/h7,9-11,14-17,19-22H,2-6,8,12-13,18,23H2,1H3/b31-30+ |
| InChIKey | NVBUOWZZJCRKNM-NVQSTNCTSA-N |
| XLogP | 9.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine?
The IUPAC name of 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine (CID 135162473) is 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine.
What is the SMILES notation for 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine?
The canonical SMILES for 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine is C=C(C/N=C(\CCCCCC)C(=C)c1ccc(SC2=CCCC=C2)cc1)c1ccccc1.
What is the InChIKey of 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine?
The InChIKey is NVBUOWZZJCRKNM-NVQSTNCTSA-N. The full InChI is InChI=1S/C30H35NS/c1-4-5-6-13-18-30(31-23-24(2)26-14-9-7-10-15-26)25(3)27-19-21-29(22-20-27)32-28-16-11-8-12-17-28/h7,9-11,14-17,19-22H,2-6,8,12-13,18,23H2,1H3/b31-30+.
What are the key properties of 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine?
2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine has a molecular weight of 441.68 g/mol, XLogP of 9.15, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexa-1,5-dien-1-ylsulfanylphenyl)-N-(2-phenylprop-2-enyl)non-1-en-3-imine is sourced from PubChem (CID 135162473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).