C17H29NO2 — CID 135162597
2-amino-1-(4-octylphenyl)propane-1,3-diol (PubChem CID 135162597) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-amino-1-(4-octylphenyl)propane-1,3-diol.
| Compound Name | 2-amino-1-(4-octylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 135162597 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-amino-1-(4-octylphenyl)propane-1,3-diol |
| SMILES | CCCCCCCCc1ccc(C(O)C(N)CO)cc1 |
| InChI | InChI=1S/C17H29NO2/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)17(20)16(18)13-19/h9-12,16-17,19-20H,2-8,13,18H2,1H3 |
| InChIKey | LSCNBGYURXZCCU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|