C59H46N2 — CID 135163375
9-[7-(3,5-dimethylphenyl)-9,9-dimethylfluoren-2-yl]-N,N-bis(4-phenylphenyl)carbazol-3-amine (PubChem CID 135163375) has the molecular formula C59H46N2 and a molecular weight of 783.03 g/mol. Its IUPAC name is 9-[7-(3,5-dimethylphenyl)-9,9-dimethylfluoren-2-yl]-N,N-bis(4-phenylphenyl)carbazol-3-amine.
| Compound Name | 9-[7-(3,5-dimethylphenyl)-9,9-dimethylfluoren-2-yl]-N,N-bis(4-phenylphenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 135163375 |
| Molecular Formula | C59H46N2 |
| Molecular Weight | 783.03 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | 9-[7-(3,5-dimethylphenyl)-9,9-dimethylfluoren-2-yl]-N,N-bis(4-phenylphenyl)carbazol-3-amine |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)C(C)(C)c2cc(-n4c5ccccc5c5cc(N(c6ccc(-c7ccccc7)cc6)c6ccc(-c7ccccc7)cc6)ccc54)ccc2-3)c1 |
| InChI | InChI=1S/C59H46N2/c1-39-33-40(2)35-46(34-39)45-23-30-51-52-31-28-50(38-56(52)59(3,4)55(51)36-45)61-57-18-12-11-17-53(57)54-37-49(29-32-58(54)61)60(47-24-19-43(20-25-47)41-13-7-5-8-14-41)48-26-21-44(22-27-48)42-15-9-6-10-16-42/h5-38H,1-4H3 |
| InChIKey | OZMQDZRMXVUQHG-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.03 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |