C26H26N4O — CID 135163599
(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinolin-4-yl]methanol (PubChem CID 135163599) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinolin-4-yl]methanol.
| Compound Name | (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 135163599 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinolin-4-yl]methanol |
| SMILES | C=CC1CN2CCC1CC2[C@H](O)c1ccnc2ccc(-c3c[nH]c4ncccc34)cc12 |
| InChI | InChI=1S/C26H26N4O/c1-2-16-15-30-11-8-17(16)13-24(30)25(31)19-7-10-27-23-6-5-18(12-21(19)23)22-14-29-26-20(22)4-3-9-28-26/h2-7,9-10,12,14,16-17,24-25,31H,1,8,11,13,15H2,(H,28,29)/t16?,17?,24?,25-/m1/s1 |
| InChIKey | MEOUPMOIPDCJAL-SPBIILDVSA-N |
| XLogP | 4.71 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|