C21H25NO2 — CID 135163861
3-(dibenzylamino)-4-methylhexane-2,5-dione (PubChem CID 135163861) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-(dibenzylamino)-4-methylhexane-2,5-dione.
| Compound Name | 3-(dibenzylamino)-4-methylhexane-2,5-dione |
|---|---|
| PubChem CID | 135163861 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-(dibenzylamino)-4-methylhexane-2,5-dione |
| SMILES | CC(=O)C(C)C(C(C)=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-16(17(2)23)21(18(3)24)22(14-19-10-6-4-7-11-19)15-20-12-8-5-9-13-20/h4-13,16,21H,14-15H2,1-3H3 |
| InChIKey | AZIFJSGRELNHSE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |