About 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one
4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one (PubChem CID 135164338) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one |
| PubChem CID | 135164338 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one |
| SMILES | Cc1nsc(N2C(=O)N(C(C)C)CC2C)n1 |
| InChI | InChI=1S/C10H16N4OS/c1-6(2)13-5-7(3)14(10(13)15)9-11-8(4)12-16-9/h6-7H,5H2,1-4H3 |
| InChIKey | YGPKQNIBRVHYCP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one?
The IUPAC name of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one (CID 135164338) is 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one.
What is the SMILES notation for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one?
The canonical SMILES for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one is Cc1nsc(N2C(=O)N(C(C)C)CC2C)n1.
What is the InChIKey of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one?
The InChIKey is YGPKQNIBRVHYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-6(2)13-5-7(3)14(10(13)15)9-11-8(4)12-16-9/h6-7H,5H2,1-4H3.
What are the key properties of 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one?
4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one has a molecular weight of 240.33 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-1-propan-2-ylimidazolidin-2-one is sourced from PubChem (CID 135164338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).