About 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one
2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one (PubChem CID 135164374) has the molecular formula C7H7N3O2S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
| PubChem CID | 135164374 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
| SMILES | CC1=CC(=O)N(c2ncns2)C1O |
| InChI | InChI=1S/C7H7N3O2S/c1-4-2-5(11)10(6(4)12)7-8-3-9-13-7/h2-3,6,12H,1H3 |
| InChIKey | QTNZQRFWZHWEPK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one?
The IUPAC name of 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one (CID 135164374) is 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one.
What is the SMILES notation for 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one?
The canonical SMILES for 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one is CC1=CC(=O)N(c2ncns2)C1O.
What is the InChIKey of 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one?
The InChIKey is QTNZQRFWZHWEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S/c1-4-2-5(11)10(6(4)12)7-8-3-9-13-7/h2-3,6,12H,1H3.
What are the key properties of 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one?
2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one has a molecular weight of 197.22 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methyl-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-5-one is sourced from PubChem (CID 135164374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).