C9H9N3O3S — CID 135164379
[3,4-dimethyl-5-oxo-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-2-yl] formate (PubChem CID 135164379) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is [3,4-dimethyl-5-oxo-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-2-yl] formate.
| Compound Name | [3,4-dimethyl-5-oxo-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-2-yl] formate |
|---|---|
| PubChem CID | 135164379 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [3,4-dimethyl-5-oxo-1-(1,2,4-thiadiazol-5-yl)-2H-pyrrol-2-yl] formate |
| SMILES | CC1=C(C)C(OC=O)N(c2ncns2)C1=O |
| InChI | InChI=1S/C9H9N3O3S/c1-5-6(2)8(15-4-13)12(7(5)14)9-10-3-11-16-9/h3-4,8H,1-2H3 |
| InChIKey | RDKJLXREZCLCND-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|