C25H24N6O2 — CID 135164420
3-[(5-spiro[1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-ylpyrimidin-2-yl)amino]cyclobutan-1-ol (PubChem CID 135164420) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 3-[(5-spiro[1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-ylpyrimidin-2-yl)amino]cyclobutan-1-ol.
| Compound Name | 3-[(5-spiro[1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-ylpyrimidin-2-yl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 135164420 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 3-[(5-spiro[1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-ylpyrimidin-2-yl)amino]cyclobutan-1-ol |
| SMILES | OC1CC(Nc2ncc(-c3ccc4nc5n(c4n3)C3(CCC5)COc4ccccc43)cn2)C1 |
| InChI | InChI=1S/C25H24N6O2/c32-17-10-16(11-17)28-24-26-12-15(13-27-24)19-7-8-20-23(30-19)31-22(29-20)6-3-9-25(31)14-33-21-5-2-1-4-18(21)25/h1-2,4-5,7-8,12-13,16-17,32H,3,6,9-11,14H2,(H,26,27,28) |
| InChIKey | OQRAXJJYNFDFHP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |