About 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole
1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole (PubChem CID 135164985) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole |
| PubChem CID | 135164985 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole |
| SMILES | CC1=C(SC(C)C)CN(C)C1 |
| InChI | InChI=1S/C9H17NS/c1-7(2)11-9-6-10(4)5-8(9)3/h7H,5-6H2,1-4H3 |
| InChIKey | KJOYGKTVQHHDME-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole?
The IUPAC name of 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole (CID 135164985) is 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole.
What is the SMILES notation for 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole?
The canonical SMILES for 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole is CC1=C(SC(C)C)CN(C)C1.
What is the InChIKey of 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole?
The InChIKey is KJOYGKTVQHHDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7(2)11-9-6-10(4)5-8(9)3/h7H,5-6H2,1-4H3.
What are the key properties of 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole?
1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole has a molecular weight of 171.31 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4-propan-2-ylsulfanyl-2,5-dihydropyrrole is sourced from PubChem (CID 135164985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).