C13H24FN3O — CID 135165387
(Z)-4-(dimethylamino)-2-fluoro-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one (PubChem CID 135165387) has the molecular formula C13H24FN3O and a molecular weight of 257.35 g/mol. Its IUPAC name is (Z)-4-(dimethylamino)-2-fluoro-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | (Z)-4-(dimethylamino)-2-fluoro-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 135165387 |
| Molecular Formula | C13H24FN3O |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (Z)-4-(dimethylamino)-2-fluoro-1-(4-propan-2-ylpiperazin-1-yl)but-2-en-1-one |
| SMILES | CC(C)N1CCN(C(=O)/C(F)=C/CN(C)C)CC1 |
| InChI | InChI=1S/C13H24FN3O/c1-11(2)16-7-9-17(10-8-16)13(18)12(14)5-6-15(3)4/h5,11H,6-10H2,1-4H3/b12-5- |
| InChIKey | GZRIKQMKWYSSCO-XGICHPGQSA-N |
| XLogP | 0.95 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|