C17H31NO — CID 135167481
1-[(1S,3aR,7aS)-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 135167481) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-[(1S,3aR,7aS)-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1S,3aR,7aS)-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 135167481 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-[(1S,3aR,7aS)-2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@@H]1[C@H]2CCCC[C@H]2CN1C(C)(C)C |
| InChI | InChI=1S/C17H31NO/c1-16(2,3)15(19)14-13-10-8-7-9-12(13)11-18(14)17(4,5)6/h12-14H,7-11H2,1-6H3/t12-,13-,14-/m0/s1 |
| InChIKey | HUYUVAORWVEUBI-IHRRRGAJSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |