C20H26F3N5O4 — CID 135169110
(2S)-3-[(2-amino-4-pyridinyl)methyl]-1-N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide (PubChem CID 135169110) has the molecular formula C20H26F3N5O4 and a molecular weight of 457.45 g/mol. Its IUPAC name is (2S)-3-[(2-amino-4-pyridinyl)methyl]-1-N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide.
| Compound Name | (2S)-3-[(2-amino-4-pyridinyl)methyl]-1-N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 135169110 |
| Molecular Formula | C20H26F3N5O4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2S)-3-[(2-amino-4-pyridinyl)methyl]-1-N-[(1S)-1-cyclohexyl-2,2,2-trifluoroethyl]-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide |
| SMILES | CONC(=O)[C@@H]1C(Cc2ccnc(N)c2)C(=O)N1C(=O)N[C@@H](C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C20H26F3N5O4/c1-32-27-17(29)15-13(9-11-7-8-25-14(24)10-11)18(30)28(15)19(31)26-16(20(21,22)23)12-5-3-2-4-6-12/h7-8,10,12-13,15-16H,2-6,9H2,1H3,(H2,24,25)(H,26,31)(H,27,29)/t13?,15-,16-/m0/s1 |
| InChIKey | OAAZNRNZGDDBMY-FMYDAXTQSA-N |
| XLogP | 1.93 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|