C20H16ClF3N8OS — CID 135169836
1-(3-amino-2-aminosulfanylphenyl)-N-[5-chloro-6-(1-methylpyrazol-3-yl)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 135169836) has the molecular formula C20H16ClF3N8OS and a molecular weight of 508.92 g/mol. Its IUPAC name is 1-(3-amino-2-aminosulfanylphenyl)-N-[5-chloro-6-(1-methylpyrazol-3-yl)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-amino-2-aminosulfanylphenyl)-N-[5-chloro-6-(1-methylpyrazol-3-yl)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135169836 |
| Molecular Formula | C20H16ClF3N8OS |
| Molecular Weight | 508.92 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 1-(3-amino-2-aminosulfanylphenyl)-N-[5-chloro-6-(1-methylpyrazol-3-yl)-3-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1ccc(-c2ncc(NC(=O)c3cnn(-c4cccc(N)c4SN)c3C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C20H16ClF3N8OS/c1-31-6-5-14(30-31)16-12(21)7-10(8-27-16)29-19(33)11-9-28-32(18(11)20(22,23)24)15-4-2-3-13(25)17(15)34-26/h2-9H,25-26H2,1H3,(H,29,33) |
| InChIKey | RBJDITPKLILELI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|