About (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine
(3S)-3-cyclohexa-2,4-dien-1-ylmorpholine (PubChem CID 135170044) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine.
Molecular Properties
| Compound Name | (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine |
| PubChem CID | 135170044 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine |
| SMILES | C1=CCC([C@H]2COCCN2)C=C1 |
| InChI | InChI=1S/C10H15NO/c1-2-4-9(5-3-1)10-8-12-7-6-11-10/h1-4,9-11H,5-8H2/t9?,10-/m1/s1 |
| InChIKey | CUZQLAVVUKAGAW-QVDQXJPCSA-N |
| XLogP | 1.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine?
The IUPAC name of (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine (CID 135170044) is (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine.
What is the SMILES notation for (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine?
The canonical SMILES for (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine is C1=CCC([C@H]2COCCN2)C=C1.
What is the InChIKey of (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine?
The InChIKey is CUZQLAVVUKAGAW-QVDQXJPCSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-4-9(5-3-1)10-8-12-7-6-11-10/h1-4,9-11H,5-8H2/t9?,10-/m1/s1.
What are the key properties of (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine?
(3S)-3-cyclohexa-2,4-dien-1-ylmorpholine has a molecular weight of 165.24 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-cyclohexa-2,4-dien-1-ylmorpholine is sourced from PubChem (CID 135170044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).