About (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane
(2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 135170224) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane.
Analyze (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The IUPAC name of (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane (CID 135170224) is (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The canonical SMILES for (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane is CN1C[C@@H]2C3CCC([C@@H]2C1)N3C.
What is the InChIKey of (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The InChIKey is LWHOQMUVPLFDHM-BQKDNTBBSA-N. The full InChI is InChI=1S/C10H18N2/c1-11-5-7-8(6-11)10-4-3-9(7)12(10)2/h7-10H,3-6H2,1-2H3/t7-,8+,9?,10?.
What are the key properties of (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane?
(2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane has a molecular weight of 166.27 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 135170224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).