C20H24F10 — CID 135170421
1,4-dimethyl-2,5-bis(5,5,6,6,6-pentafluorohexyl)benzene (PubChem CID 135170421) has the molecular formula C20H24F10 and a molecular weight of 454.39 g/mol. Its IUPAC name is 1,4-dimethyl-2,5-bis(5,5,6,6,6-pentafluorohexyl)benzene.
| Compound Name | 1,4-dimethyl-2,5-bis(5,5,6,6,6-pentafluorohexyl)benzene |
|---|---|
| PubChem CID | 135170421 |
| Molecular Formula | C20H24F10 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1,4-dimethyl-2,5-bis(5,5,6,6,6-pentafluorohexyl)benzene |
| SMILES | Cc1cc(CCCCC(F)(F)C(F)(F)F)c(C)cc1CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H24F10/c1-13-11-16(8-4-6-10-18(23,24)20(28,29)30)14(2)12-15(13)7-3-5-9-17(21,22)19(25,26)27/h11-12H,3-10H2,1-2H3 |
| InChIKey | PDLBOGZRXGRZMM-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|