C40H44N6O2 — CID 135170437
2-methyl-N-[3-[[10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]-3-(2-pyridin-2-yl-4-pyridinyl)anthracen-9-yl]methylamino]propyl]prop-2-enamide (PubChem CID 135170437) has the molecular formula C40H44N6O2 and a molecular weight of 640.83 g/mol. Its IUPAC name is 2-methyl-N-[3-[[10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]-3-(2-pyridin-2-yl-4-pyridinyl)anthracen-9-yl]methylamino]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[[10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]-3-(2-pyridin-2-yl-4-pyridinyl)anthracen-9-yl]methylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 135170437 |
| Molecular Formula | C40H44N6O2 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 2-methyl-N-[3-[[10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]-3-(2-pyridin-2-yl-4-pyridinyl)anthracen-9-yl]methylamino]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCNCc1c2ccccc2c(CNCCCNC(=O)C(=C)C)c2cc(-c3ccnc(-c4ccccn4)c3)ccc12 |
| InChI | InChI=1S/C40H44N6O2/c1-27(2)39(47)45-20-9-17-41-25-35-31-11-5-6-12-32(31)36(26-42-18-10-21-46-40(48)28(3)4)34-23-29(14-15-33(34)35)30-16-22-44-38(24-30)37-13-7-8-19-43-37/h5-8,11-16,19,22-24,41-42H,1,3,9-10,17-18,20-21,25-26H2,2,4H3,(H,45,47)(H,46,48) |
| InChIKey | UHPYKMQNLKVYBD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|