About (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate
(1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate (PubChem CID 135170518) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate |
| PubChem CID | 135170518 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate |
| SMILES | CC1=CC(OC(=O)C(C)(C)C)N(C)C1=O |
| InChI | InChI=1S/C11H17NO3/c1-7-6-8(12(5)9(7)13)15-10(14)11(2,3)4/h6,8H,1-5H3 |
| InChIKey | AJEWTBGBPLZQDO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate?
The IUPAC name of (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate (CID 135170518) is (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate is CC1=CC(OC(=O)C(C)(C)C)N(C)C1=O.
What is the InChIKey of (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate?
The InChIKey is AJEWTBGBPLZQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-7-6-8(12(5)9(7)13)15-10(14)11(2,3)4/h6,8H,1-5H3.
What are the key properties of (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate?
(1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate has a molecular weight of 211.26 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethyl-5-oxo-2H-pyrrol-2-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 135170518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).