C6H4F5NS — CID 135170598
3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazole (PubChem CID 135170598) has the molecular formula C6H4F5NS and a molecular weight of 217.16 g/mol. Its IUPAC name is 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazole.
| Compound Name | 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazole |
|---|---|
| PubChem CID | 135170598 |
| Molecular Formula | C6H4F5NS |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2-thiazole |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)sn1 |
| InChI | InChI=1S/C6H4F5NS/c1-3-2-4(13-12-3)5(7,8)6(9,10)11/h2H,1H3 |
| InChIKey | OSVRNVUZXINEHV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|