C7H8ClNO — CID 135170631
3-(1-chlorocyclopropyl)-5-methyl-1,2-oxazole (PubChem CID 135170631) has the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. Its IUPAC name is 3-(1-chlorocyclopropyl)-5-methyl-1,2-oxazole.
| Compound Name | 3-(1-chlorocyclopropyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 135170631 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 3-(1-chlorocyclopropyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(C2(Cl)CC2)no1 |
| InChI | InChI=1S/C7H8ClNO/c1-5-4-6(9-10-5)7(8)2-3-7/h4H,2-3H2,1H3 |
| InChIKey | AQBATQVWZYPWSE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|