C7H7F5N2S3 — CID 135170707
5-methyl-3-[2-(1,1,2,2,2-pentafluoroethylsulfanyl)ethylsulfanyl]-1,2,4-thiadiazole (PubChem CID 135170707) has the molecular formula C7H7F5N2S3 and a molecular weight of 310.34 g/mol. Its IUPAC name is 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethylsulfanyl)ethylsulfanyl]-1,2,4-thiadiazole.
| Compound Name | 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethylsulfanyl)ethylsulfanyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 135170707 |
| Molecular Formula | C7H7F5N2S3 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethylsulfanyl)ethylsulfanyl]-1,2,4-thiadiazole |
| SMILES | Cc1nc(SCCSC(F)(F)C(F)(F)F)ns1 |
| InChI | InChI=1S/C7H7F5N2S3/c1-4-13-5(14-17-4)15-2-3-16-7(11,12)6(8,9)10/h2-3H2,1H3 |
| InChIKey | YVCYHFWOSGZXQU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|