About N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine
N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine (PubChem CID 135171641) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine.
Molecular Properties
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine |
| PubChem CID | 135171641 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine |
| SMILES | C=C/C=C/N(CC(C)C)C1CCOCC1 |
| InChI | InChI=1S/C13H23NO/c1-4-5-8-14(11-12(2)3)13-6-9-15-10-7-13/h4-5,8,12-13H,1,6-7,9-11H2,2-3H3/b8-5+ |
| InChIKey | KQHZBEQWHPCWKA-VMPITWQZSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine?
The IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine (CID 135171641) is N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine.
What is the SMILES notation for N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine?
The canonical SMILES for N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine is C=C/C=C/N(CC(C)C)C1CCOCC1.
What is the InChIKey of N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine?
The InChIKey is KQHZBEQWHPCWKA-VMPITWQZSA-N. The full InChI is InChI=1S/C13H23NO/c1-4-5-8-14(11-12(2)3)13-6-9-15-10-7-13/h4-5,8,12-13H,1,6-7,9-11H2,2-3H3/b8-5+.
What are the key properties of N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine?
N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine has a molecular weight of 209.33 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-buta-1,3-dienyl]-N-(2-methylpropyl)oxan-4-amine is sourced from PubChem (CID 135171641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).