C27H29N7 — CID 135172166
4-[2-(2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl)-5-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]pyrimidin-4-yl]benzonitrile (PubChem CID 135172166) has the molecular formula C27H29N7 and a molecular weight of 451.58 g/mol. Its IUPAC name is 4-[2-(2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl)-5-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-(2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl)-5-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 135172166 |
| Molecular Formula | C27H29N7 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 4-[2-(2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl)-5-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]pyrimidin-4-yl]benzonitrile |
| SMILES | C=NNc1cc(-c2cnc(N3CCC4CNCC4CC3)nc2-c2ccc(C#N)cc2)ccc1C |
| InChI | InChI=1S/C27H29N7/c1-18-3-6-21(13-25(18)33-29-2)24-17-31-27(32-26(24)20-7-4-19(14-28)5-8-20)34-11-9-22-15-30-16-23(22)10-12-34/h3-8,13,17,22-23,30,33H,2,9-12,15-16H2,1H3 |
| InChIKey | SFBGDMUUFQPOLQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|